About (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane
(5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane (PubChem CID 39354685) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane.
Molecular Properties
| Compound Name | (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane |
| PubChem CID | 39354685 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane |
| SMILES | CCCCCC1(CCCCC)OCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H30O2/c1-3-5-10-14-19(15-11-6-4-2)18(20-16-21-19)17-12-8-7-9-13-17/h7-9,12-13,18H,3-6,10-11,14-16H2,1-2H3/t18-/m1/s1 |
| InChIKey | LLPPXXCOLMSDPS-GOSISDBHSA-N |
| XLogP | 5.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane?
The IUPAC name of (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane (CID 39354685) is (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane.
What is the SMILES notation for (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane?
The canonical SMILES for (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane is CCCCCC1(CCCCC)OCO[C@@H]1c1ccccc1.
What is the InChIKey of (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane?
The InChIKey is LLPPXXCOLMSDPS-GOSISDBHSA-N. The full InChI is InChI=1S/C19H30O2/c1-3-5-10-14-19(15-11-6-4-2)18(20-16-21-19)17-12-8-7-9-13-17/h7-9,12-13,18H,3-6,10-11,14-16H2,1-2H3/t18-/m1/s1.
What are the key properties of (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane?
(5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane has a molecular weight of 290.45 g/mol, XLogP of 5.63, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4,4-dipentyl-5-phenyl-1,3-dioxolane is sourced from PubChem (CID 39354685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).