C23H17ClN2O5 — CID 39358414
[4-[(E)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 39358414) has the molecular formula C23H17ClN2O5 and a molecular weight of 436.85 g/mol. Its IUPAC name is [4-[(E)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[(E)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 39358414 |
| Molecular Formula | C23H17ClN2O5 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | [4-[(E)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/NC(=O)[C@@H]2COc3ccccc3O2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN2O5/c24-17-9-7-16(8-10-17)23(28)30-18-11-5-15(6-12-18)13-25-26-22(27)21-14-29-19-3-1-2-4-20(19)31-21/h1-13,21H,14H2,(H,26,27)/b25-13+/t21-/m0/s1 |
| InChIKey | KTXNMYOIYPBTEC-LHXREVONSA-N |
| XLogP | 3.85 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|