About 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol
1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol (PubChem CID 39363376) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol |
| PubChem CID | 39363376 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol |
| SMILES | Cc1ccc(OCCCN2CCC(O)CC2)c(C)c1 |
| InChI | InChI=1S/C16H25NO2/c1-13-4-5-16(14(2)12-13)19-11-3-8-17-9-6-15(18)7-10-17/h4-5,12,15,18H,3,6-11H2,1-2H3 |
| InChIKey | XJNUIIAVLAICAO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol?
The IUPAC name of 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol (CID 39363376) is 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol.
What is the SMILES notation for 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol?
The canonical SMILES for 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol is Cc1ccc(OCCCN2CCC(O)CC2)c(C)c1.
What is the InChIKey of 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol?
The InChIKey is XJNUIIAVLAICAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-13-4-5-16(14(2)12-13)19-11-3-8-17-9-6-15(18)7-10-17/h4-5,12,15,18H,3,6-11H2,1-2H3.
What are the key properties of 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol?
1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol has a molecular weight of 263.38 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,4-dimethylphenoxy)propyl]piperidin-4-ol is sourced from PubChem (CID 39363376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).