C17H21NO2 — CID 39371047
2-[2-(3,5-dimethylphenoxy)ethoxy]-5-methylaniline (PubChem CID 39371047) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylphenoxy)ethoxy]-5-methylaniline.
| Compound Name | 2-[2-(3,5-dimethylphenoxy)ethoxy]-5-methylaniline |
|---|---|
| PubChem CID | 39371047 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-[2-(3,5-dimethylphenoxy)ethoxy]-5-methylaniline |
| SMILES | Cc1cc(C)cc(OCCOc2ccc(C)cc2N)c1 |
| InChI | InChI=1S/C17H21NO2/c1-12-4-5-17(16(18)11-12)20-7-6-19-15-9-13(2)8-14(3)10-15/h4-5,8-11H,6-7,18H2,1-3H3 |
| InChIKey | NLWZJFGRAQRQSK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|