C30H32N4O5 — CID 3937127
ethyl 11-methyl-2-oxo-6-(3-phenylprop-2-enoylimino)-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 3937127) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is ethyl 11-methyl-2-oxo-6-(3-phenylprop-2-enoylimino)-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 11-methyl-2-oxo-6-(3-phenylprop-2-enoylimino)-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 3937127 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | ethyl 11-methyl-2-oxo-6-(3-phenylprop-2-enoylimino)-7-(3-propan-2-yloxypropyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(=O)n3cccc(C)c3nc2n(CCCOC(C)C)/c1=N\C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C30H32N4O5/c1-5-38-30(37)24-19-23-27(32-26-21(4)11-9-16-34(26)29(23)36)33(17-10-18-39-20(2)3)28(24)31-25(35)15-14-22-12-7-6-8-13-22/h6-9,11-16,19-20H,5,10,17-18H2,1-4H3/b15-14?,31-28- |
| InChIKey | JDLWZMFBRCMIGF-LETDDWLPSA-N |
| XLogP | 4.09 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|