C20H13ClIN3O2 — CID 3937131
3-(4-chlorophenyl)-5-[[1-(4-iodophenyl)pyrrol-2-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 3937131) has the molecular formula C20H13ClIN3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[[1-(4-iodophenyl)pyrrol-2-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 3-(4-chlorophenyl)-5-[[1-(4-iodophenyl)pyrrol-2-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3937131 |
| Molecular Formula | C20H13ClIN3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[[1-(4-iodophenyl)pyrrol-2-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=Cc2cccn2-c2ccc(I)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H13ClIN3O2/c21-13-3-7-16(8-4-13)25-19(26)18(23-20(25)27)12-17-2-1-11-24(17)15-9-5-14(22)6-10-15/h1-12H,(H,23,27) |
| InChIKey | HGWIRIGLIIRZTL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|