C12H9Cl2N3 — CID 3937585
N-[(3,4-dichlorophenyl)methylideneamino]pyridin-2-amine (PubChem CID 3937585) has the molecular formula C12H9Cl2N3 and a molecular weight of 266.13 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(3,4-dichlorophenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 3937585 |
| Molecular Formula | C12H9Cl2N3 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methylideneamino]pyridin-2-amine |
| SMILES | Clc1ccc(C=NNc2ccccn2)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N3/c13-10-5-4-9(7-11(10)14)8-16-17-12-3-1-2-6-15-12/h1-8H,(H,15,17) |
| InChIKey | PJFHCTPYWZVYAF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|