C24H24N4O6 — CID 39377524
(5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 39377524) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 39377524 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (5S)-3-(1,3-benzodioxol-5-ylmethyl)-5-[2-oxo-2-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(C[C@@H]1NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O)N1C[C@@H]2C[C@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C24H24N4O6/c29-21-3-1-2-18-16-6-15(11-27(18)21)9-26(12-16)22(30)8-17-23(31)28(24(32)25-17)10-14-4-5-19-20(7-14)34-13-33-19/h1-5,7,15-17H,6,8-13H2,(H,25,32)/t15-,16+,17-/m0/s1 |
| InChIKey | UTIXKEOYJWEMTM-BBWFWOEESA-N |
| XLogP | 1.03 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|