C19H16N2O4 — CID 39377695
6,7-dimethoxy-1-phenyl-4H-indeno[2,1-d]pyrazole-3-carboxylic acid (PubChem CID 39377695) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 6,7-dimethoxy-1-phenyl-4H-indeno[2,1-d]pyrazole-3-carboxylic acid.
| Compound Name | 6,7-dimethoxy-1-phenyl-4H-indeno[2,1-d]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 39377695 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 6,7-dimethoxy-1-phenyl-4H-indeno[2,1-d]pyrazole-3-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)-c1c(c(C(=O)O)nn1-c1ccccc1)C2 |
| InChI | InChI=1S/C19H16N2O4/c1-24-15-9-11-8-14-17(19(22)23)20-21(12-6-4-3-5-7-12)18(14)13(11)10-16(15)25-2/h3-7,9-10H,8H2,1-2H3,(H,22,23) |
| InChIKey | RXUPYSBKYUAPKX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |