C14H13N3O2 — CID 39378180
11,13-dimethyl-5-prop-2-enyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 39378180) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 11,13-dimethyl-5-prop-2-enyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11,13-dimethyl-5-prop-2-enyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 39378180 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 11,13-dimethyl-5-prop-2-enyl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | C=CCn1cnc2c(oc3nc(C)cc(C)c32)c1=O |
| InChI | InChI=1S/C14H13N3O2/c1-4-5-17-7-15-11-10-8(2)6-9(3)16-13(10)19-12(11)14(17)18/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | VWDABGBRIMOWSG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|