C15H21N4+ — CID 3938007
4-N-ethyl-6-N,1,2-trimethyl-4-N-phenylpyrimidin-1-ium-4,6-diamine (PubChem CID 3938007) has the molecular formula C15H21N4+ and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-N-ethyl-6-N,1,2-trimethyl-4-N-phenylpyrimidin-1-ium-4,6-diamine.
| Compound Name | 4-N-ethyl-6-N,1,2-trimethyl-4-N-phenylpyrimidin-1-ium-4,6-diamine |
|---|---|
| PubChem CID | 3938007 |
| Molecular Formula | C15H21N4+ |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4-N-ethyl-6-N,1,2-trimethyl-4-N-phenylpyrimidin-1-ium-4,6-diamine |
| SMILES | CCN(c1ccccc1)c1cc(NC)[n+](C)c(C)n1 |
| InChI | InChI=1S/C15H20N4/c1-5-19(13-9-7-6-8-10-13)15-11-14(16-3)18(4)12(2)17-15/h6-11H,5H2,1-4H3/p+1 |
| InChIKey | JABSKGQQWUDVRU-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 32.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|