C19H25NO — CID 39384036
N-[(3-butoxyphenyl)methyl]-2,6-dimethylaniline (PubChem CID 39384036) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is N-[(3-butoxyphenyl)methyl]-2,6-dimethylaniline.
| Compound Name | N-[(3-butoxyphenyl)methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 39384036 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-[(3-butoxyphenyl)methyl]-2,6-dimethylaniline |
| SMILES | CCCCOc1cccc(CNc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C19H25NO/c1-4-5-12-21-18-11-7-10-17(13-18)14-20-19-15(2)8-6-9-16(19)3/h6-11,13,20H,4-5,12,14H2,1-3H3 |
| InChIKey | MORHGRQEHWARFW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|