About 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone
1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone (PubChem CID 3938631) has the molecular formula C39H34FNO
and a molecular weight of 551.71 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone |
| PubChem CID | 3938631 |
| Molecular Formula | C39H34FNO |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone |
| SMILES | CC1=CC(C)(C)N(CC(=O)c2ccc(F)cc2)c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C39H34FNO/c1-28-26-38(2,3)41(27-37(42)29-19-22-34(40)23-20-29)36-24-21-33(25-35(28)36)39(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-26H,27H2,1-3H3 |
| InChIKey | HFULWWYKYCRMEH-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
The IUPAC name of 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone (CID 3938631) is 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone.
What is the SMILES notation for 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
The canonical SMILES for 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone is CC1=CC(C)(C)N(CC(=O)c2ccc(F)cc2)c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21.
What is the InChIKey of 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
The InChIKey is HFULWWYKYCRMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H34FNO/c1-28-26-38(2,3)41(27-37(42)29-19-22-34(40)23-20-29)36-24-21-33(25-35(28)36)39(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-26H,27H2,1-3H3.
What are the key properties of 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone has a molecular weight of 551.71 g/mol, XLogP of 9.09, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone is sourced from PubChem (CID 3938631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).