C23H21N3O8S — CID 39388465
ethyl (2Z,5R)-5-(3,4-dimethoxyphenyl)-7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 39388465) has the molecular formula C23H21N3O8S and a molecular weight of 499.50 g/mol. Its IUPAC name is ethyl (2Z,5R)-5-(3,4-dimethoxyphenyl)-7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-5-(3,4-dimethoxyphenyl)-7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 39388465 |
| Molecular Formula | C23H21N3O8S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | ethyl (2Z,5R)-5-(3,4-dimethoxyphenyl)-7-methyl-2-[(5-nitrofuran-2-yl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C\c3ccc([N+](=O)[O-])o3)c(=O)n2[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H21N3O8S/c1-5-33-22(28)19-12(2)24-23-25(20(19)13-6-8-15(31-3)16(10-13)32-4)21(27)17(35-23)11-14-7-9-18(34-14)26(29)30/h6-11,20H,5H2,1-4H3/b17-11-/t20-/m1/s1 |
| InChIKey | LPOFZFHOQVUWMQ-ZZODWALSSA-N |
| XLogP | 2.32 |
| TPSA | 135.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|