C15H13Cl2NO2 — CID 3939481
1-(2,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 3939481) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-(2,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 3939481 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)C(c1ccc(Cl)cc1Cl)NCC2 |
| InChI | InChI=1S/C15H13Cl2NO2/c16-9-1-2-10(12(17)6-9)15-11-7-14(20)13(19)5-8(11)3-4-18-15/h1-2,5-7,15,18-20H,3-4H2 |
| InChIKey | BKSZHUYQRBSSEN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|