C18H30N2O — CID 39396373
N'-cycloheptyl-N'-[(3-ethoxyphenyl)methyl]ethane-1,2-diamine (PubChem CID 39396373) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N'-cycloheptyl-N'-[(3-ethoxyphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-cycloheptyl-N'-[(3-ethoxyphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 39396373 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N'-cycloheptyl-N'-[(3-ethoxyphenyl)methyl]ethane-1,2-diamine |
| SMILES | CCOc1cccc(CN(CCN)C2CCCCCC2)c1 |
| InChI | InChI=1S/C18H30N2O/c1-2-21-18-11-7-8-16(14-18)15-20(13-12-19)17-9-5-3-4-6-10-17/h7-8,11,14,17H,2-6,9-10,12-13,15,19H2,1H3 |
| InChIKey | GHYROVYPZTTZAA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |