C22H21Cl2N3O3S — CID 3940110
5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 3940110) has the molecular formula C22H21Cl2N3O3S and a molecular weight of 478.40 g/mol. Its IUPAC name is 5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3940110 |
| Molecular Formula | C22H21Cl2N3O3S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 5-[[1-(2,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(C=C2SC(=O)N(CC(=O)N3CCCC3)C2=O)c(C)n1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H21Cl2N3O3S/c1-13-9-15(14(2)27(13)18-11-16(23)5-6-17(18)24)10-19-21(29)26(22(30)31-19)12-20(28)25-7-3-4-8-25/h5-6,9-11H,3-4,7-8,12H2,1-2H3 |
| InChIKey | GIQRIRBFQYMPFF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|