C15H19ClN2O2 — CID 39404103
2-[(4-tert-butylphenoxy)methyl]-5-(2-chloroethyl)-1,3,4-oxadiazole (PubChem CID 39404103) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-[(4-tert-butylphenoxy)methyl]-5-(2-chloroethyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(4-tert-butylphenoxy)methyl]-5-(2-chloroethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 39404103 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-[(4-tert-butylphenoxy)methyl]-5-(2-chloroethyl)-1,3,4-oxadiazole |
| SMILES | CC(C)(C)c1ccc(OCc2nnc(CCCl)o2)cc1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-15(2,3)11-4-6-12(7-5-11)19-10-14-18-17-13(20-14)8-9-16/h4-7H,8-10H2,1-3H3 |
| InChIKey | RHKIMNXZUQVKLE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|