C33H28N2O5S — CID 3940483
2-methoxyethyl 2-(anthracen-9-ylmethylidene)-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3940483) has the molecular formula C33H28N2O5S and a molecular weight of 564.66 g/mol. Its IUPAC name is 2-methoxyethyl 2-(anthracen-9-ylmethylidene)-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 2-(anthracen-9-ylmethylidene)-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3940483 |
| Molecular Formula | C33H28N2O5S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 2-methoxyethyl 2-(anthracen-9-ylmethylidene)-5-(2-methoxyphenyl)-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=c2sc(=Cc3c4ccccc4cc4ccccc34)c(=O)n2C1c1ccccc1OC |
| InChI | InChI=1S/C33H28N2O5S/c1-20-29(32(37)40-17-16-38-2)30(25-14-8-9-15-27(25)39-3)35-31(36)28(41-33(35)34-20)19-26-23-12-6-4-10-21(23)18-22-11-5-7-13-24(22)26/h4-15,18-19,30H,16-17H2,1-3H3 |
| InChIKey | FSRUVUZGQNYZQY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|