2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid

C14H20N2O3S — CID 39406625

IUPAC2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid
SMILESCCCCC(=O)N1CCC(c2nc(C(=O)O)cs2)CC1
InChIInChI=1S/C14H20N2O3S/c1-2-3-4-12(17)16-7-5-10(6-8-16)13-15-11(9-20-13)14(18)19/h9-10H,2-8H2,1H3,(H,18,19)
InChIKeyBZQYJPDXIORIEZ-UHFFFAOYSA-N
MW296.39 g/mol
LogP2.74
Rot. Bonds5

About 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid

2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 39406625) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid
PubChem CID39406625
Molecular FormulaC14H20N2O3S
Molecular Weight296.39 g/mol
Exact Mass296.12
IUPAC Name2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid
SMILESCCCCC(=O)N1CCC(c2nc(C(=O)O)cs2)CC1
InChIInChI=1S/C14H20N2O3S/c1-2-3-4-12(17)16-7-5-10(6-8-16)13-15-11(9-20-13)14(18)19/h9-10H,2-8H2,1H3,(H,18,19)
InChIKeyBZQYJPDXIORIEZ-UHFFFAOYSA-N
XLogP2.74
TPSA70.50 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.39
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid (CID 39406625) is 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid is CCCCC(=O)N1CCC(c2nc(C(=O)O)cs2)CC1.
What is the InChIKey of 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is BZQYJPDXIORIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3S/c1-2-3-4-12(17)16-7-5-10(6-8-16)13-15-11(9-20-13)14(18)19/h9-10H,2-8H2,1H3,(H,18,19).
What are the key properties of 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid?
2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 296.39 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-pentanoylpiperidin-4-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 39406625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).