About 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole
2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole (PubChem CID 3940763) has the molecular formula C20H13F2NOS
and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole |
| PubChem CID | 3940763 |
| Molecular Formula | C20H13F2NOS |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole |
| SMILES | FC(F)Oc1ccc(C=Cc2nc3c(ccc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C20H13F2NOS/c21-20(22)24-15-9-5-13(6-10-15)7-12-18-23-19-16-4-2-1-3-14(16)8-11-17(19)25-18/h1-12,20H |
| InChIKey | OBKPPRUACYMBOF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole?
The IUPAC name of 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole (CID 3940763) is 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole.
What is the SMILES notation for 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole?
The canonical SMILES for 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole is FC(F)Oc1ccc(C=Cc2nc3c(ccc4ccccc43)s2)cc1.
What is the InChIKey of 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole?
The InChIKey is OBKPPRUACYMBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F2NOS/c21-20(22)24-15-9-5-13(6-10-15)7-12-18-23-19-16-4-2-1-3-14(16)8-11-17(19)25-18/h1-12,20H.
What are the key properties of 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole?
2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole has a molecular weight of 353.39 g/mol, XLogP of 6.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(difluoromethoxy)phenyl]ethenyl]benzo[e][1,3]benzothiazole is sourced from PubChem (CID 3940763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).