C23H19FN4O2 — CID 3940824
3-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide (PubChem CID 3940824) has the molecular formula C23H19FN4O2 and a molecular weight of 402.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3940824 |
| Molecular Formula | C23H19FN4O2 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(4-methoxyphenyl)-N-(pyridin-4-ylmethyl)pyrazole-5-carboxamide |
| SMILES | COc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)NCc2ccncc2)cc1 |
| InChI | InChI=1S/C23H19FN4O2/c1-30-20-8-6-19(7-9-20)28-22(23(29)26-15-16-10-12-25-13-11-16)14-21(27-28)17-2-4-18(24)5-3-17/h2-14H,15H2,1H3,(H,26,29) |
| InChIKey | IVBBFIMBSFQMAM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |