C25H24N4O6 — CID 3941369
2'-(2-methoxy-4-nitrophenyl)-5,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 3941369) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is 2'-(2-methoxy-4-nitrophenyl)-5,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | 2'-(2-methoxy-4-nitrophenyl)-5,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 3941369 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2'-(2-methoxy-4-nitrophenyl)-5,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1C(=O)C2C3CCCN3C3(C(=O)Nc4c(C)cc(C)cc43)C2C1=O |
| InChI | InChI=1S/C25H24N4O6/c1-12-9-13(2)21-15(10-12)25(24(32)26-21)20-19(17-5-4-8-27(17)25)22(30)28(23(20)31)16-7-6-14(29(33)34)11-18(16)35-3/h6-7,9-11,17,19-20H,4-5,8H2,1-3H3,(H,26,32) |
| InChIKey | GKDNGYRMOYIJID-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|