About 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate
5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate (PubChem CID 3941557) has the molecular formula C6H6N4O3
and a molecular weight of 182.14 g/mol. Its IUPAC name is 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate.
Molecular Properties
| Compound Name | 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
| PubChem CID | 3941557 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate |
| SMILES | Cn1c([O-])c([N+]#N)c(=O)n(C)c1=O |
| InChI | InChI=1S/C6H6N4O3/c1-9-4(11)3(8-7)5(12)10(2)6(9)13/h1-2H3 |
| InChIKey | XMYWRBXSIQINSE-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 95.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate?
The IUPAC name of 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate (CID 3941557) is 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate.
What is the SMILES notation for 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate?
The canonical SMILES for 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate is Cn1c([O-])c([N+]#N)c(=O)n(C)c1=O.
What is the InChIKey of 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate?
The InChIKey is XMYWRBXSIQINSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O3/c1-9-4(11)3(8-7)5(12)10(2)6(9)13/h1-2H3.
What are the key properties of 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate?
5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate has a molecular weight of 182.14 g/mol, XLogP of -1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazonio-1,3-dimethyl-2,6-dioxopyrimidin-4-olate is sourced from PubChem (CID 3941557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).