C13H11F6N5O — CID 3942679
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 3942679) has the molecular formula C13H11F6N5O and a molecular weight of 367.25 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3942679 |
| Molecular Formula | C13H11F6N5O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccccc2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C13H11F6N5O/c1-20-9-22-10(21-7-5-3-2-4-6-7)24-11(23-9)25-8(12(14,15)16)13(17,18)19/h2-6,8H,1H3,(H2,20,21,22,23,24) |
| InChIKey | IQWQRKAECXHZKW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |