C19H18N2O2 — CID 39428151
N-(2,3-dimethylphenyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide (PubChem CID 39428151) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 39428151 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(2-phenyl-1,3-oxazol-4-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2coc(-c3ccccc3)n2)c1C |
| InChI | InChI=1S/C19H18N2O2/c1-13-7-6-10-17(14(13)2)21-18(22)11-16-12-23-19(20-16)15-8-4-3-5-9-15/h3-10,12H,11H2,1-2H3,(H,21,22) |
| InChIKey | XDDAAZJBJHYASL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |