C18H14BrF2N3OS — CID 3943247
N-(4-bromophenyl)-4-(2,6-difluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 3943247) has the molecular formula C18H14BrF2N3OS and a molecular weight of 438.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(2,6-difluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(4-bromophenyl)-4-(2,6-difluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 3943247 |
| Molecular Formula | C18H14BrF2N3OS |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | N-(4-bromophenyl)-4-(2,6-difluorophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Br)cc2)C(c2c(F)cccc2F)NC(=S)N1 |
| InChI | InChI=1S/C18H14BrF2N3OS/c1-9-14(17(25)23-11-7-5-10(19)6-8-11)16(24-18(26)22-9)15-12(20)3-2-4-13(15)21/h2-8,16H,1H3,(H,23,25)(H2,22,24,26) |
| InChIKey | BDNGYHGLPVNMAR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|