C16H19NO3S — CID 39436095
4-(3-hydroxypropyl)-N-(3-methylphenyl)benzenesulfonamide (PubChem CID 39436095) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-(3-hydroxypropyl)-N-(3-methylphenyl)benzenesulfonamide.
| Compound Name | 4-(3-hydroxypropyl)-N-(3-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39436095 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 4-(3-hydroxypropyl)-N-(3-methylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(CCCO)cc2)c1 |
| InChI | InChI=1S/C16H19NO3S/c1-13-4-2-6-15(12-13)17-21(19,20)16-9-7-14(8-10-16)5-3-11-18/h2,4,6-10,12,17-18H,3,5,11H2,1H3 |
| InChIKey | FECYIWPWOYEUSS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |