About [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (PubChem CID 3943726) has the molecular formula C12H16N2O5S
and a molecular weight of 300.34 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| PubChem CID | 3943726 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)OCC(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16N2O5S/c1-14-5-2-3-10(14)12(16)19-7-11(15)13-9-4-6-20(17,18)8-9/h2-3,5,9H,4,6-8H2,1H3,(H,13,15) |
| InChIKey | FRWCEBIFWHNQOK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate?
The IUPAC name of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate (CID 3943726) is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate.
What is the SMILES notation for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate?
The canonical SMILES for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate is Cn1cccc1C(=O)OCC(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate?
The InChIKey is FRWCEBIFWHNQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O5S/c1-14-5-2-3-10(14)12(16)19-7-11(15)13-9-4-6-20(17,18)8-9/h2-3,5,9H,4,6-8H2,1H3,(H,13,15).
What are the key properties of [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate?
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate has a molecular weight of 300.34 g/mol, XLogP of -0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 3943726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).