About 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid
6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid (PubChem CID 3944427) has the molecular formula C16H27NO5S
and a molecular weight of 345.46 g/mol. Its IUPAC name is 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid.
Molecular Properties
| Compound Name | 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid |
| PubChem CID | 3944427 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)NCCCCCC(=O)O)C(=O)C2 |
| InChI | InChI=1S/C16H27NO5S/c1-15(2)12-7-8-16(15,13(18)10-12)11-23(21,22)17-9-5-3-4-6-14(19)20/h12,17H,3-11H2,1-2H3,(H,19,20) |
| InChIKey | RMGLEMNTOUMUJU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid?
The IUPAC name of 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid (CID 3944427) is 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid.
What is the SMILES notation for 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid?
The canonical SMILES for 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid is CC1(C)C2CCC1(CS(=O)(=O)NCCCCCC(=O)O)C(=O)C2.
What is the InChIKey of 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid?
The InChIKey is RMGLEMNTOUMUJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO5S/c1-15(2)12-7-8-16(15,13(18)10-12)11-23(21,22)17-9-5-3-4-6-14(19)20/h12,17H,3-11H2,1-2H3,(H,19,20).
What are the key properties of 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid?
6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid has a molecular weight of 345.46 g/mol, XLogP of 1.95, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylsulfonylamino]hexanoic acid is sourced from PubChem (CID 3944427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).