About 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one
1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one (PubChem CID 39455921) has the molecular formula C15H11Cl3O
and a molecular weight of 313.61 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one |
| PubChem CID | 39455921 |
| Molecular Formula | C15H11Cl3O |
| Molecular Weight | 313.61 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(Cl)cc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3O/c16-12-4-1-10(2-5-12)7-13(19)8-11-3-6-14(17)15(18)9-11/h1-6,9H,7-8H2 |
| InChIKey | MZFBAZCPWXKSOJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one?
The IUPAC name of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one (CID 39455921) is 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one.
What is the SMILES notation for 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one?
The canonical SMILES for 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one is O=C(Cc1ccc(Cl)cc1)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one?
The InChIKey is MZFBAZCPWXKSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl3O/c16-12-4-1-10(2-5-12)7-13(19)8-11-3-6-14(17)15(18)9-11/h1-6,9H,7-8H2.
What are the key properties of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one?
1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one has a molecular weight of 313.61 g/mol, XLogP of 5.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)propan-2-one is sourced from PubChem (CID 39455921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).