C19H26N2O4 — CID 394565
Diethyl 3-phenethyl-4-vinyl-pyrazolidine-1,2-dicarboxylate (PubChem CID 394565) has the molecular formula C19H26N2O4 and a molecular weight of 346.40 g/mol. Its IUPAC name is diethyl 4-ethenyl-3-(2-phenylethyl)pyrazolidine-1,2-dicarboxylate.
| Compound Name | Diethyl 3-phenethyl-4-vinyl-pyrazolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 394565 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | diethyl 4-ethenyl-3-(2-phenylethyl)pyrazolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)N1CC(C(N1C(=O)OCC)CCC2=CC=CC=C2)C=C |
| InChI | InChI=1S/C19H26N2O4/c1-4-16-14-20(18(22)24-5-2)21(19(23)25-6-3)17(16)13-12-15-10-8-7-9-11-15/h4,7-11,16-17H,1,5-6,12-14H2,2-3H3 |
| InChIKey | SUXWFTZVOWZAJI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | 462 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|