C29H20N4O3 — CID 3946796
6-[(5-methyl-2-naphthalen-1-yl-3-oxo-1H-pyrazol-4-yl)methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 3946796) has the molecular formula C29H20N4O3 and a molecular weight of 472.50 g/mol. Its IUPAC name is 6-[(5-methyl-2-naphthalen-1-yl-3-oxo-1H-pyrazol-4-yl)methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-[(5-methyl-2-naphthalen-1-yl-3-oxo-1H-pyrazol-4-yl)methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 3946796 |
| Molecular Formula | C29H20N4O3 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 6-[(5-methyl-2-naphthalen-1-yl-3-oxo-1H-pyrazol-4-yl)methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | Cc1[nH]n(-c2cccc3ccccc23)c(=O)c1C=NN1C(=O)c2ccc3c4c(ccc(c24)C1=O)CC3 |
| InChI | InChI=1S/C29H20N4O3/c1-16-23(29(36)32(31-16)24-8-4-6-17-5-2-3-7-20(17)24)15-30-33-27(34)21-13-11-18-9-10-19-12-14-22(28(33)35)26(21)25(18)19/h2-8,11-15,31H,9-10H2,1H3 |
| InChIKey | PGAFLXXPQDZGJA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|