C18H17N3O3S — CID 3947440
2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 3947440) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3947440 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-N-(4-methyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1cccc2sc(NC(=O)CN3C(=O)C4CC=CCC4C3=O)nc12 |
| InChI | InChI=1S/C18H17N3O3S/c1-10-5-4-8-13-15(10)20-18(25-13)19-14(22)9-21-16(23)11-6-2-3-7-12(11)17(21)24/h2-5,8,11-12H,6-7,9H2,1H3,(H,19,20,22) |
| InChIKey | AWCQWAIIMKDLAK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|