C20H23N5OS — CID 39476767
N'-benzyl-N'-phenyl-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide (PubChem CID 39476767) has the molecular formula C20H23N5OS and a molecular weight of 381.50 g/mol. Its IUPAC name is N'-benzyl-N'-phenyl-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide.
| Compound Name | N'-benzyl-N'-phenyl-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 39476767 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N'-benzyl-N'-phenyl-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
| SMILES | CC(C)n1cnnc1SCC(=O)NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23N5OS/c1-16(2)24-15-21-22-20(24)27-14-19(26)23-25(18-11-7-4-8-12-18)13-17-9-5-3-6-10-17/h3-12,15-16H,13-14H2,1-2H3,(H,23,26) |
| InChIKey | AYJHMCIUERGHIK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|