C19H13ClN6O2 — CID 3948205
4-[10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]benzene-1,3-diol (PubChem CID 3948205) has the molecular formula C19H13ClN6O2 and a molecular weight of 392.81 g/mol. Its IUPAC name is 4-[10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]benzene-1,3-diol.
| Compound Name | 4-[10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 3948205 |
| Molecular Formula | C19H13ClN6O2 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 4-[10-(5-chloro-2-methylphenyl)-3,4,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]benzene-1,3-diol |
| SMILES | Cc1ccc(Cl)cc1-n1ncc2c1ncn1c(-c3ccc(O)cc3O)nnc21 |
| InChI | InChI=1S/C19H13ClN6O2/c1-10-2-3-11(20)6-15(10)26-17-14(8-22-26)19-24-23-18(25(19)9-21-17)13-5-4-12(27)7-16(13)28/h2-9,27-28H,1H3 |
| InChIKey | LIETVMFBALHDHW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |