C14H12N2O4 — CID 3948761
4-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)benzene-1,3-diol (PubChem CID 3948761) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)benzene-1,3-diol.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 3948761 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)benzene-1,3-diol |
| SMILES | Oc1ccc(/N=N/c2ccc3c(c2)OCCO3)c(O)c1 |
| InChI | InChI=1S/C14H12N2O4/c17-10-2-3-11(12(18)8-10)16-15-9-1-4-13-14(7-9)20-6-5-19-13/h1-4,7-8,17-18H,5-6H2/b16-15+ |
| InChIKey | WSTAZLFQFPBEJK-FOCLMDBBSA-N |
| XLogP | 3.28 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|