C15H19N3O4 — CID 3948884
2-[(phenylcarbamoylamino)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 3948884) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[(phenylcarbamoylamino)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(phenylcarbamoylamino)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 3948884 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-[(phenylcarbamoylamino)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NNC(=O)C1CCCCC1C(=O)O)Nc1ccccc1 |
| InChI | InChI=1S/C15H19N3O4/c19-13(11-8-4-5-9-12(11)14(20)21)17-18-15(22)16-10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2,(H,17,19)(H,20,21)(H2,16,18,22) |
| InChIKey | ORQOZKVDQYLLTO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|