C23H18N4O4S — CID 3950094
3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(9,10,10-trioxothioxanthen-3-yl)prop-2-enenitrile (PubChem CID 3950094) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(9,10,10-trioxothioxanthen-3-yl)prop-2-enenitrile.
| Compound Name | 3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(9,10,10-trioxothioxanthen-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3950094 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 3-hydroxy-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(9,10,10-trioxothioxanthen-3-yl)prop-2-enenitrile |
| SMILES | N#CC(=C(O)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C23H18N4O4S/c24-13-17(23-26-25-20-8-2-1-5-11-27(20)23)21(28)14-9-10-16-19(12-14)32(30,31)18-7-4-3-6-15(18)22(16)29/h3-4,6-7,9-10,12,28H,1-2,5,8,11H2 |
| InChIKey | GIIYQEAGKQHBRQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|