About [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate
[4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate (PubChem CID 3950346) has the molecular formula C18H19NO5S
and a molecular weight of 361.42 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate.
Molecular Properties
| Compound Name | [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate |
| PubChem CID | 3950346 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate |
| SMILES | COc1ccc(-c2ccc(OC(=O)NC3CCS(=O)(=O)C3)cc2)cc1 |
| InChI | InChI=1S/C18H19NO5S/c1-23-16-6-2-13(3-7-16)14-4-8-17(9-5-14)24-18(20)19-15-10-11-25(21,22)12-15/h2-9,15H,10-12H2,1H3,(H,19,20) |
| InChIKey | PKGHZMWLENDTNT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate?
The IUPAC name of [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate (CID 3950346) is [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate.
What is the SMILES notation for [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate?
The canonical SMILES for [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate is COc1ccc(-c2ccc(OC(=O)NC3CCS(=O)(=O)C3)cc2)cc1.
What is the InChIKey of [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate?
The InChIKey is PKGHZMWLENDTNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5S/c1-23-16-6-2-13(3-7-16)14-4-8-17(9-5-14)24-18(20)19-15-10-11-25(21,22)12-15/h2-9,15H,10-12H2,1H3,(H,19,20).
What are the key properties of [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate?
[4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate has a molecular weight of 361.42 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methoxyphenyl)phenyl] N-(1,1-dioxothiolan-3-yl)carbamate is sourced from PubChem (CID 3950346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).