C16H12ClN3OS2 — CID 3950354
(3-cyano-4,6-dimethyl-2-pyridinyl) N-(4-chlorobenzoyl)carbamodithioate (PubChem CID 3950354) has the molecular formula C16H12ClN3OS2 and a molecular weight of 361.88 g/mol. Its IUPAC name is (3-cyano-4,6-dimethyl-2-pyridinyl) N-(4-chlorobenzoyl)carbamodithioate.
| Compound Name | (3-cyano-4,6-dimethyl-2-pyridinyl) N-(4-chlorobenzoyl)carbamodithioate |
|---|---|
| PubChem CID | 3950354 |
| Molecular Formula | C16H12ClN3OS2 |
| Molecular Weight | 361.88 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | (3-cyano-4,6-dimethyl-2-pyridinyl) N-(4-chlorobenzoyl)carbamodithioate |
| SMILES | Cc1cc(C)c(C#N)c(SC(=S)NC(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H12ClN3OS2/c1-9-7-10(2)19-15(13(9)8-18)23-16(22)20-14(21)11-3-5-12(17)6-4-11/h3-7H,1-2H3,(H,20,21,22) |
| InChIKey | JCDHCSBVZXUHNA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|