C23H18BrCl3N2O2 — CID 3951281
N-benzyl-2-[(4-bromophenyl)methyl-(2,2,2-trichloroacetyl)amino]benzamide (PubChem CID 3951281) has the molecular formula C23H18BrCl3N2O2 and a molecular weight of 540.67 g/mol. Its IUPAC name is N-benzyl-2-[(4-bromophenyl)methyl-(2,2,2-trichloroacetyl)amino]benzamide.
| Compound Name | N-benzyl-2-[(4-bromophenyl)methyl-(2,2,2-trichloroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 3951281 |
| Molecular Formula | C23H18BrCl3N2O2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 537.96 |
| IUPAC Name | N-benzyl-2-[(4-bromophenyl)methyl-(2,2,2-trichloroacetyl)amino]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccccc1N(Cc1ccc(Br)cc1)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H18BrCl3N2O2/c24-18-12-10-17(11-13-18)15-29(22(31)23(25,26)27)20-9-5-4-8-19(20)21(30)28-14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,28,30) |
| InChIKey | PICHBDUYVOZWTN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|