About [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate (PubChem CID 3951571) has the molecular formula C17H21F2N3O6S
and a molecular weight of 433.43 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate |
| PubChem CID | 3951571 |
| Molecular Formula | C17H21F2N3O6S |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1c(F)cccc1F)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H21F2N3O6S/c18-12-7-4-8-13(19)16(12)29(26,27)20-9-15(24)28-10-14(23)22-17(25)21-11-5-2-1-3-6-11/h4,7-8,11,20H,1-3,5-6,9-10H2,(H2,21,22,23,25) |
| InChIKey | OXRJPABTKSJPND-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate?
The IUPAC name of [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate (CID 3951571) is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate.
What is the SMILES notation for [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate?
The canonical SMILES for [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate is O=C(COC(=O)CNS(=O)(=O)c1c(F)cccc1F)NC(=O)NC1CCCCC1.
What is the InChIKey of [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate?
The InChIKey is OXRJPABTKSJPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O6S/c18-12-7-4-8-13(19)16(12)29(26,27)20-9-15(24)28-10-14(23)22-17(25)21-11-5-2-1-3-6-11/h4,7-8,11,20H,1-3,5-6,9-10H2,(H2,21,22,23,25).
What are the key properties of [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate?
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate has a molecular weight of 433.43 g/mol, XLogP of 0.94, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-[(2,6-difluorophenyl)sulfonylamino]acetate is sourced from PubChem (CID 3951571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).