C28H21N5O2S — CID 3951658
4'-methyl-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] (PubChem CID 3951658) has the molecular formula C28H21N5O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is 4'-methyl-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine].
| Compound Name | 4'-methyl-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
|---|---|
| PubChem CID | 3951658 |
| Molecular Formula | C28H21N5O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4'-methyl-5-(4-nitrophenyl)-2',3-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
| SMILES | CC1=NN(c2ccccc2)C2(SC(c3ccc([N+](=O)[O-])cc3)=NN2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H21N5O2S/c1-20-25-14-8-9-15-26(25)28(31(29-20)22-10-4-2-5-11-22)32(23-12-6-3-7-13-23)30-27(36-28)21-16-18-24(19-17-21)33(34)35/h2-19H,1H3 |
| InChIKey | XLSSRPLBQGTYMQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|