C14H18N2O2S — CID 3951936
2-sulfanylidene-5-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]-1,3-diazinane-4,6-dione (PubChem CID 3951936) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-sulfanylidene-5-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | 2-sulfanylidene-5-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3951936 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-sulfanylidene-5-[(2,6,6-trimethylcyclohex-2-en-1-yl)methylidene]-1,3-diazinane-4,6-dione |
| SMILES | CC1=CCCC(C)(C)C1C=C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C14H18N2O2S/c1-8-5-4-6-14(2,3)10(8)7-9-11(17)15-13(19)16-12(9)18/h5,7,10H,4,6H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | RFJLKLZHSWXMDM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|