C21H38NO2+ — CID 3952272
methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium (PubChem CID 3952272) has the molecular formula C21H38NO2+ and a molecular weight of 336.54 g/mol. Its IUPAC name is methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium.
| Compound Name | methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium |
|---|---|
| PubChem CID | 3952272 |
| Molecular Formula | C21H38NO2+ |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | methyl-bis(1,2,2,3-tetramethylcyclopentanecarbonyl)azanium |
| SMILES | CC1CCC(C)(C(=O)[NH+](C)C(=O)C2(C)CCC(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C21H37NO2/c1-14-10-12-20(7,18(14,3)4)16(23)22(9)17(24)21(8)13-11-15(2)19(21,5)6/h14-15H,10-13H2,1-9H3/p+1 |
| InChIKey | BHUKNCSDHSSDAL-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|