C23H28N2O — CID 3952387
N,N-diethyl-1',3',3'-trimethylspiro[chromene-2,2'-indole]-7-amine (PubChem CID 3952387) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is N,N-diethyl-1',3',3'-trimethylspiro[chromene-2,2'-indole]-7-amine.
| Compound Name | N,N-diethyl-1',3',3'-trimethylspiro[chromene-2,2'-indole]-7-amine |
|---|---|
| PubChem CID | 3952387 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N,N-diethyl-1',3',3'-trimethylspiro[chromene-2,2'-indole]-7-amine |
| SMILES | CCN(CC)c1ccc2c(c1)OC1(C=C2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C23H28N2O/c1-6-25(7-2)18-13-12-17-14-15-23(26-21(17)16-18)22(3,4)19-10-8-9-11-20(19)24(23)5/h8-16H,6-7H2,1-5H3 |
| InChIKey | MPHHMIODJUJOPC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|