C19H31NO8 — CID 3953097
methyl 6-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]hexanoate (PubChem CID 3953097) has the molecular formula C19H31NO8 and a molecular weight of 401.46 g/mol. Its IUPAC name is methyl 6-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]hexanoate.
| Compound Name | methyl 6-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 3953097 |
| Molecular Formula | C19H31NO8 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | methyl 6-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C1OC2OC(C)(C)OC2C2OC(C)(C)OC12 |
| InChI | InChI=1S/C19H31NO8/c1-18(2)25-12-13(26-18)15-17(28-19(3,4)27-15)24-14(12)16(22)20-10-8-6-7-9-11(21)23-5/h12-15,17H,6-10H2,1-5H3,(H,20,22) |
| InChIKey | KLZFIXTYAIRKBF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|