C23H25N5O3S2 — CID 39532820
2-[3-(2,3-dimethylphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)acetamide (PubChem CID 39532820) has the molecular formula C23H25N5O3S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 2-[3-(2,3-dimethylphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)acetamide.
| Compound Name | 2-[3-(2,3-dimethylphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 39532820 |
| Molecular Formula | C23H25N5O3S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-[3-(2,3-dimethylphenyl)-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanyl-N-(5-propan-2-yl-1,3,4-oxadiazol-2-yl)acetamide |
| SMILES | Cc1cccc(-n2c(SCC(=O)Nc3nnc(C(C)C)o3)nc3sc(C)c(C)c3c2=O)c1C |
| InChI | InChI=1S/C23H25N5O3S2/c1-11(2)19-26-27-22(31-19)24-17(29)10-32-23-25-20-18(14(5)15(6)33-20)21(30)28(23)16-9-7-8-12(3)13(16)4/h7-9,11H,10H2,1-6H3,(H,24,27,29) |
| InChIKey | OWGJDQGQRNMCKG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |