About 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one (PubChem CID 39533725) has the molecular formula C16H16ClN3OS
and a molecular weight of 333.84 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one |
| PubChem CID | 39533725 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one |
| SMILES | CC(C)(C)c1nc(Cn2cnc3ccc(Cl)cc3c2=O)cs1 |
| InChI | InChI=1S/C16H16ClN3OS/c1-16(2,3)15-19-11(8-22-15)7-20-9-18-13-5-4-10(17)6-12(13)14(20)21/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | FGNPKMRRBOIDGA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one?
The IUPAC name of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one (CID 39533725) is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one.
What is the SMILES notation for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one?
The canonical SMILES for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one is CC(C)(C)c1nc(Cn2cnc3ccc(Cl)cc3c2=O)cs1.
What is the InChIKey of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one?
The InChIKey is FGNPKMRRBOIDGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3OS/c1-16(2,3)15-19-11(8-22-15)7-20-9-18-13-5-4-10(17)6-12(13)14(20)21/h4-6,8-9H,7H2,1-3H3.
What are the key properties of 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one?
3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one has a molecular weight of 333.84 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-6-chloroquinazolin-4-one is sourced from PubChem (CID 39533725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).